C12H15Cl2NO — CID 171162059
(1R,2S)-2-amino-1-cyclobutyl-2-(2,6-dichlorophenyl)ethanol (PubChem CID 171162059) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-cyclobutyl-2-(2,6-dichlorophenyl)ethanol.
| Compound Name | (1R,2S)-2-amino-1-cyclobutyl-2-(2,6-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 171162059 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | (1R,2S)-2-amino-1-cyclobutyl-2-(2,6-dichlorophenyl)ethanol |
| SMILES | N[C@@H](c1c(Cl)cccc1Cl)[C@H](O)C1CCC1 |
| InChI | InChI=1S/C12H15Cl2NO/c13-8-5-2-6-9(14)10(8)11(15)12(16)7-3-1-4-7/h2,5-7,11-12,16H,1,3-4,15H2/t11-,12+/m0/s1 |
| InChIKey | UVQZBHWDOBRRCT-NWDGAFQWSA-N |
| XLogP | 3.15 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |