C12H15Cl2N — CID 171197935
(R)-cyclopentyl-(2,6-dichlorophenyl)methanamine (PubChem CID 171197935) has the molecular formula C12H15Cl2N and a molecular weight of 244.16 g/mol. Its IUPAC name is (R)-cyclopentyl-(2,6-dichlorophenyl)methanamine.
| Compound Name | (R)-cyclopentyl-(2,6-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 171197935 |
| Molecular Formula | C12H15Cl2N |
| Molecular Weight | 244.16 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | (R)-cyclopentyl-(2,6-dichlorophenyl)methanamine |
| SMILES | N[C@@H](c1c(Cl)cccc1Cl)C1CCCC1 |
| InChI | InChI=1S/C12H15Cl2N/c13-9-6-3-7-10(14)11(9)12(15)8-4-1-2-5-8/h3,6-8,12H,1-2,4-5,15H2/t12-/m1/s1 |
| InChIKey | BBUIBKNPPANIQW-GFCCVEGCSA-N |
| XLogP | 4.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.16 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |