C10H12Cl3N — CID 119031584
cyclopropyl-(2,6-dichlorophenyl)methanamine;hydrochloride (PubChem CID 119031584) has the molecular formula C10H12Cl3N and a molecular weight of 252.57 g/mol. Its IUPAC name is cyclopropyl-(2,6-dichlorophenyl)methanamine;hydrochloride.
| Compound Name | cyclopropyl-(2,6-dichlorophenyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 119031584 |
| Molecular Formula | C10H12Cl3N |
| Molecular Weight | 252.57 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | cyclopropyl-(2,6-dichlorophenyl)methanamine;hydrochloride |
| SMILES | Cl.NC(c1c(Cl)cccc1Cl)C1CC1 |
| InChI | InChI=1S/C10H11Cl2N.ClH/c11-7-2-1-3-8(12)9(7)10(13)6-4-5-6;/h1-3,6,10H,4-5,13H2;1H |
| InChIKey | QSNJNYNVBAQNIP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |