C11H13Cl2NO — CID 171161214
(1S,2R)-2-amino-1-cyclopropyl-2-(2,3-dichlorophenyl)ethanol (PubChem CID 171161214) has the molecular formula C11H13Cl2NO and a molecular weight of 246.14 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-cyclopropyl-2-(2,3-dichlorophenyl)ethanol.
| Compound Name | (1S,2R)-2-amino-1-cyclopropyl-2-(2,3-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 171161214 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | (1S,2R)-2-amino-1-cyclopropyl-2-(2,3-dichlorophenyl)ethanol |
| SMILES | N[C@H](c1cccc(Cl)c1Cl)[C@@H](O)C1CC1 |
| InChI | InChI=1S/C11H13Cl2NO/c12-8-3-1-2-7(9(8)13)10(14)11(15)6-4-5-6/h1-3,6,10-11,15H,4-5,14H2/t10-,11+/m1/s1 |
| InChIKey | YKMOFEHPQRODBZ-MNOVXSKESA-N |
| XLogP | 2.76 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |