About cyclobutyl-(2,3-dichlorophenyl)methanol
cyclobutyl-(2,3-dichlorophenyl)methanol (PubChem CID 64986948) has the molecular formula C11H12Cl2O
and a molecular weight of 231.12 g/mol. Its IUPAC name is cyclobutyl-(2,3-dichlorophenyl)methanol.
Molecular Properties
| Compound Name | cyclobutyl-(2,3-dichlorophenyl)methanol |
| PubChem CID | 64986948 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | cyclobutyl-(2,3-dichlorophenyl)methanol |
| SMILES | OC(c1cccc(Cl)c1Cl)C1CCC1 |
| InChI | InChI=1S/C11H12Cl2O/c12-9-6-2-5-8(10(9)13)11(14)7-3-1-4-7/h2,5-7,11,14H,1,3-4H2 |
| InChIKey | GNECQZJNJJYDEM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclobutyl-(2,3-dichlorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl-(2,3-dichlorophenyl)methanol?
The IUPAC name of cyclobutyl-(2,3-dichlorophenyl)methanol (CID 64986948) is cyclobutyl-(2,3-dichlorophenyl)methanol.
What is the SMILES notation for cyclobutyl-(2,3-dichlorophenyl)methanol?
The canonical SMILES for cyclobutyl-(2,3-dichlorophenyl)methanol is OC(c1cccc(Cl)c1Cl)C1CCC1.
What is the InChIKey of cyclobutyl-(2,3-dichlorophenyl)methanol?
The InChIKey is GNECQZJNJJYDEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2O/c12-9-6-2-5-8(10(9)13)11(14)7-3-1-4-7/h2,5-7,11,14H,1,3-4H2.
What are the key properties of cyclobutyl-(2,3-dichlorophenyl)methanol?
cyclobutyl-(2,3-dichlorophenyl)methanol has a molecular weight of 231.12 g/mol, XLogP of 3.83, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl-(2,3-dichlorophenyl)methanol is sourced from PubChem (CID 64986948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).