C11H12Cl2O — CID 64986948
cyclobutyl-(2,3-dichlorophenyl)methanol (PubChem CID 64986948) has the molecular formula C11H12Cl2O and a molecular weight of 231.12 g/mol. Its IUPAC name is cyclobutyl-(2,3-dichlorophenyl)methanol.
| Compound Name | cyclobutyl-(2,3-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 64986948 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | cyclobutyl-(2,3-dichlorophenyl)methanol |
| SMILES | OC(c1cccc(Cl)c1Cl)C1CCC1 |
| InChI | InChI=1S/C11H12Cl2O/c12-9-6-2-5-8(10(9)13)11(14)7-3-1-4-7/h2,5-7,11,14H,1,3-4H2 |
| InChIKey | GNECQZJNJJYDEM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |