C13H17Cl2N — CID 64986692
N-[cyclobutyl-(2,3-dichlorophenyl)methyl]ethanamine (PubChem CID 64986692) has the molecular formula C13H17Cl2N and a molecular weight of 258.19 g/mol. Its IUPAC name is N-[cyclobutyl-(2,3-dichlorophenyl)methyl]ethanamine.
| Compound Name | N-[cyclobutyl-(2,3-dichlorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 64986692 |
| Molecular Formula | C13H17Cl2N |
| Molecular Weight | 258.19 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | N-[cyclobutyl-(2,3-dichlorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cccc(Cl)c1Cl)C1CCC1 |
| InChI | InChI=1S/C13H17Cl2N/c1-2-16-13(9-5-3-6-9)10-7-4-8-11(14)12(10)15/h4,7-9,13,16H,2-3,5-6H2,1H3 |
| InChIKey | LWKIULIJXBYXLH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.19 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |