C14H18F3N — CID 64986342
N-[cyclobutyl-[2-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 64986342) has the molecular formula C14H18F3N and a molecular weight of 257.30 g/mol. Its IUPAC name is N-[cyclobutyl-[2-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | N-[cyclobutyl-[2-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 64986342 |
| Molecular Formula | C14H18F3N |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-[cyclobutyl-[2-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | CCNC(c1ccccc1C(F)(F)F)C1CCC1 |
| InChI | InChI=1S/C14H18F3N/c1-2-18-13(10-6-5-7-10)11-8-3-4-9-12(11)14(15,16)17/h3-4,8-10,13,18H,2,5-7H2,1H3 |
| InChIKey | CLDLJIVAXSLELR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |