C17H20Cl2O — CID 115792955
2-adamantyl-(2,3-dichlorophenyl)methanol (PubChem CID 115792955) has the molecular formula C17H20Cl2O and a molecular weight of 311.25 g/mol. Its IUPAC name is 2-adamantyl-(2,3-dichlorophenyl)methanol.
| Compound Name | 2-adamantyl-(2,3-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 115792955 |
| Molecular Formula | C17H20Cl2O |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-adamantyl-(2,3-dichlorophenyl)methanol |
| SMILES | OC(c1cccc(Cl)c1Cl)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H20Cl2O/c18-14-3-1-2-13(16(14)19)17(20)15-11-5-9-4-10(7-11)8-12(15)6-9/h1-3,9-12,15,17,20H,4-8H2 |
| InChIKey | NHLNUPISJGBNML-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |