C18H22Cl2O — CID 115801925
1-(2-adamantyl)-2-(2,5-dichlorophenyl)ethanol (PubChem CID 115801925) has the molecular formula C18H22Cl2O and a molecular weight of 325.28 g/mol. Its IUPAC name is 1-(2-adamantyl)-2-(2,5-dichlorophenyl)ethanol.
| Compound Name | 1-(2-adamantyl)-2-(2,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 115801925 |
| Molecular Formula | C18H22Cl2O |
| Molecular Weight | 325.28 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-(2-adamantyl)-2-(2,5-dichlorophenyl)ethanol |
| SMILES | OC(Cc1cc(Cl)ccc1Cl)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H22Cl2O/c19-15-1-2-16(20)12(8-15)9-17(21)18-13-4-10-3-11(6-13)7-14(18)5-10/h1-2,8,10-11,13-14,17-18,21H,3-7,9H2 |
| InChIKey | ALVOMUCXVYCSMG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |