C15H18ClFO — CID 102618237
1-(2-bicyclo[2.2.1]heptanyl)-2-(2-chloro-5-fluorophenyl)ethanol (PubChem CID 102618237) has the molecular formula C15H18ClFO and a molecular weight of 268.76 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-2-(2-chloro-5-fluorophenyl)ethanol.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-(2-chloro-5-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 102618237 |
| Molecular Formula | C15H18ClFO |
| Molecular Weight | 268.76 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-(2-chloro-5-fluorophenyl)ethanol |
| SMILES | OC(Cc1cc(F)ccc1Cl)C1CC2CCC1C2 |
| InChI | InChI=1S/C15H18ClFO/c16-14-4-3-12(17)7-11(14)8-15(18)13-6-9-1-2-10(13)5-9/h3-4,7,9-10,13,15,18H,1-2,5-6,8H2 |
| InChIKey | NSCLNISKTFQCST-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |