C16H21ClO — CID 121456482
1-(2-bicyclo[2.2.2]octanyl)-2-(4-chlorophenyl)ethanol (PubChem CID 121456482) has the molecular formula C16H21ClO and a molecular weight of 264.80 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.2]octanyl)-2-(4-chlorophenyl)ethanol.
| Compound Name | 1-(2-bicyclo[2.2.2]octanyl)-2-(4-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 121456482 |
| Molecular Formula | C16H21ClO |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-(2-bicyclo[2.2.2]octanyl)-2-(4-chlorophenyl)ethanol |
| SMILES | OC(Cc1ccc(Cl)cc1)C1CC2CCC1CC2 |
| InChI | InChI=1S/C16H21ClO/c17-14-7-3-12(4-8-14)10-16(18)15-9-11-1-5-13(15)6-2-11/h3-4,7-8,11,13,15-16,18H,1-2,5-6,9-10H2 |
| InChIKey | DLZSXMVKAYOITC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |