C17H24O — CID 63017843
1-(2-bicyclo[2.2.1]heptanyl)-2-(3,4-dimethylphenyl)ethanol (PubChem CID 63017843) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-2-(3,4-dimethylphenyl)ethanol.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-(3,4-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 63017843 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-2-(3,4-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(CC(O)C2CC3CCC2C3)cc1C |
| InChI | InChI=1S/C17H24O/c1-11-3-4-13(7-12(11)2)10-17(18)16-9-14-5-6-15(16)8-14/h3-4,7,14-18H,5-6,8-10H2,1-2H3 |
| InChIKey | VENDGQNSKUGPDC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |