C20H29N — CID 81099428
1-(2-adamantyl)-2-(3,4-dimethylphenyl)ethanamine (PubChem CID 81099428) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 1-(2-adamantyl)-2-(3,4-dimethylphenyl)ethanamine.
| Compound Name | 1-(2-adamantyl)-2-(3,4-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 81099428 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 1-(2-adamantyl)-2-(3,4-dimethylphenyl)ethanamine |
| SMILES | Cc1ccc(CC(N)C2C3CC4CC(C3)CC2C4)cc1C |
| InChI | InChI=1S/C20H29N/c1-12-3-4-14(5-13(12)2)11-19(21)20-17-7-15-6-16(9-17)10-18(20)8-15/h3-5,15-20H,6-11,21H2,1-2H3 |
| InChIKey | BCXGPFKFSFFTMY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |