C13H22 — CID 143912284
1,2-dimethyl-4-(2-methylpropyl)benzene;methane (PubChem CID 143912284) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 1,2-dimethyl-4-(2-methylpropyl)benzene;methane.
| Compound Name | 1,2-dimethyl-4-(2-methylpropyl)benzene;methane |
|---|---|
| PubChem CID | 143912284 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 1,2-dimethyl-4-(2-methylpropyl)benzene;methane |
| SMILES | C.Cc1ccc(CC(C)C)cc1C |
| InChI | InChI=1S/C12H18.CH4/c1-9(2)7-12-6-5-10(3)11(4)8-12;/h5-6,8-9H,7H2,1-4H3;1H4 |
| InChIKey | GMROFUHFMRSKGG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |