C14H22 — CID 91377891
4-(2-ethylbutyl)-1,2-dimethylbenzene (PubChem CID 91377891) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 4-(2-ethylbutyl)-1,2-dimethylbenzene.
| Compound Name | 4-(2-ethylbutyl)-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 91377891 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 4-(2-ethylbutyl)-1,2-dimethylbenzene |
| SMILES | CCC(CC)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H22/c1-5-13(6-2)10-14-8-7-11(3)12(4)9-14/h7-9,13H,5-6,10H2,1-4H3 |
| InChIKey | WTCMQKZNMMEQRY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |