C13H19Cl — CID 63520209
4-(2-chloro-3-methylbutyl)-1,2-dimethylbenzene (PubChem CID 63520209) has the molecular formula C13H19Cl and a molecular weight of 210.75 g/mol. Its IUPAC name is 4-(2-chloro-3-methylbutyl)-1,2-dimethylbenzene.
| Compound Name | 4-(2-chloro-3-methylbutyl)-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 63520209 |
| Molecular Formula | C13H19Cl |
| Molecular Weight | 210.75 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 4-(2-chloro-3-methylbutyl)-1,2-dimethylbenzene |
| SMILES | Cc1ccc(CC(Cl)C(C)C)cc1C |
| InChI | InChI=1S/C13H19Cl/c1-9(2)13(14)8-12-6-5-10(3)11(4)7-12/h5-7,9,13H,8H2,1-4H3 |
| InChIKey | GRMZRSUSVZHQDO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.75 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|