C11H12ClN — CID 82054377
2-chloro-3-(3,4-dimethylphenyl)propanenitrile (PubChem CID 82054377) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is 2-chloro-3-(3,4-dimethylphenyl)propanenitrile.
| Compound Name | 2-chloro-3-(3,4-dimethylphenyl)propanenitrile |
|---|---|
| PubChem CID | 82054377 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-chloro-3-(3,4-dimethylphenyl)propanenitrile |
| SMILES | Cc1ccc(CC(Cl)C#N)cc1C |
| InChI | InChI=1S/C11H12ClN/c1-8-3-4-10(5-9(8)2)6-11(12)7-13/h3-5,11H,6H2,1-2H3 |
| InChIKey | WGONNCCDBCXMJZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|