C14H19Cl — CID 130553721
4-[2-chloro-2-(1-methylcyclopropyl)ethyl]-1,2-dimethylbenzene (PubChem CID 130553721) has the molecular formula C14H19Cl and a molecular weight of 222.76 g/mol. Its IUPAC name is 4-[2-chloro-2-(1-methylcyclopropyl)ethyl]-1,2-dimethylbenzene.
| Compound Name | 4-[2-chloro-2-(1-methylcyclopropyl)ethyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 130553721 |
| Molecular Formula | C14H19Cl |
| Molecular Weight | 222.76 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 4-[2-chloro-2-(1-methylcyclopropyl)ethyl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(CC(Cl)C2(C)CC2)cc1C |
| InChI | InChI=1S/C14H19Cl/c1-10-4-5-12(8-11(10)2)9-13(15)14(3)6-7-14/h4-5,8,13H,6-7,9H2,1-3H3 |
| InChIKey | WCDMUSRXIZTFAT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|