C18H19Cl — CID 66396801
7-[1-chloro-2-(3,4-dimethylphenyl)ethyl]bicyclo[4.2.0]octa-1,3,5-triene (PubChem CID 66396801) has the molecular formula C18H19Cl and a molecular weight of 270.80 g/mol. Its IUPAC name is 7-[1-chloro-2-(3,4-dimethylphenyl)ethyl]bicyclo[4.2.0]octa-1,3,5-triene.
| Compound Name | 7-[1-chloro-2-(3,4-dimethylphenyl)ethyl]bicyclo[4.2.0]octa-1,3,5-triene |
|---|---|
| PubChem CID | 66396801 |
| Molecular Formula | C18H19Cl |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 7-[1-chloro-2-(3,4-dimethylphenyl)ethyl]bicyclo[4.2.0]octa-1,3,5-triene |
| SMILES | Cc1ccc(CC(Cl)C2Cc3ccccc32)cc1C |
| InChI | InChI=1S/C18H19Cl/c1-12-7-8-14(9-13(12)2)10-18(19)17-11-15-5-3-4-6-16(15)17/h3-9,17-18H,10-11H2,1-2H3 |
| InChIKey | VAWZPEJXORAUTJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|