C14H19N — CID 116931638
2-[(3,4-dimethylphenyl)methyl]-3-methylbutanenitrile (PubChem CID 116931638) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)methyl]-3-methylbutanenitrile.
| Compound Name | 2-[(3,4-dimethylphenyl)methyl]-3-methylbutanenitrile |
|---|---|
| PubChem CID | 116931638 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)methyl]-3-methylbutanenitrile |
| SMILES | Cc1ccc(CC(C#N)C(C)C)cc1C |
| InChI | InChI=1S/C14H19N/c1-10(2)14(9-15)8-13-6-5-11(3)12(4)7-13/h5-7,10,14H,8H2,1-4H3 |
| InChIKey | JBGBUWGPRFAHOR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |