C18H20Br2 — CID 66041895
4-[2-(bromomethyl)-3-(4-bromophenyl)propyl]-1,2-dimethylbenzene (PubChem CID 66041895) has the molecular formula C18H20Br2 and a molecular weight of 396.17 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-3-(4-bromophenyl)propyl]-1,2-dimethylbenzene.
| Compound Name | 4-[2-(bromomethyl)-3-(4-bromophenyl)propyl]-1,2-dimethylbenzene |
|---|---|
| PubChem CID | 66041895 |
| Molecular Formula | C18H20Br2 |
| Molecular Weight | 396.17 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 4-[2-(bromomethyl)-3-(4-bromophenyl)propyl]-1,2-dimethylbenzene |
| SMILES | Cc1ccc(CC(CBr)Cc2ccc(Br)cc2)cc1C |
| InChI | InChI=1S/C18H20Br2/c1-13-3-4-16(9-14(13)2)11-17(12-19)10-15-5-7-18(20)8-6-15/h3-9,17H,10-12H2,1-2H3 |
| InChIKey | GNAOETFZKUIPHB-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.17 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|