C18H23F2N — CID 81099599
1-(2-adamantyl)-2-(2,6-difluorophenyl)ethanamine (PubChem CID 81099599) has the molecular formula C18H23F2N and a molecular weight of 291.38 g/mol. Its IUPAC name is 1-(2-adamantyl)-2-(2,6-difluorophenyl)ethanamine.
| Compound Name | 1-(2-adamantyl)-2-(2,6-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 81099599 |
| Molecular Formula | C18H23F2N |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-(2-adamantyl)-2-(2,6-difluorophenyl)ethanamine |
| SMILES | NC(Cc1c(F)cccc1F)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H23F2N/c19-15-2-1-3-16(20)14(15)9-17(21)18-12-5-10-4-11(7-12)8-13(18)6-10/h1-3,10-13,17-18H,4-9,21H2 |
| InChIKey | SOHBJUANILQGIO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |