C14H19F2NS — CID 114932106
1-cyclopentylsulfanyl-3-(2,6-difluorophenyl)propan-2-amine (PubChem CID 114932106) has the molecular formula C14H19F2NS and a molecular weight of 271.38 g/mol. Its IUPAC name is 1-cyclopentylsulfanyl-3-(2,6-difluorophenyl)propan-2-amine.
| Compound Name | 1-cyclopentylsulfanyl-3-(2,6-difluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 114932106 |
| Molecular Formula | C14H19F2NS |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-cyclopentylsulfanyl-3-(2,6-difluorophenyl)propan-2-amine |
| SMILES | NC(CSC1CCCC1)Cc1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2NS/c15-13-6-3-7-14(16)12(13)8-10(17)9-18-11-4-1-2-5-11/h3,6-7,10-11H,1-2,4-5,8-9,17H2 |
| InChIKey | PMRZWZQKYSSDEC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |