C17H25F2NS — CID 114932112
1-cyclohexylsulfanyl-3-(2,6-difluorophenyl)-N-ethylpropan-2-amine (PubChem CID 114932112) has the molecular formula C17H25F2NS and a molecular weight of 313.46 g/mol. Its IUPAC name is 1-cyclohexylsulfanyl-3-(2,6-difluorophenyl)-N-ethylpropan-2-amine.
| Compound Name | 1-cyclohexylsulfanyl-3-(2,6-difluorophenyl)-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 114932112 |
| Molecular Formula | C17H25F2NS |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 1-cyclohexylsulfanyl-3-(2,6-difluorophenyl)-N-ethylpropan-2-amine |
| SMILES | CCNC(CSC1CCCCC1)Cc1c(F)cccc1F |
| InChI | InChI=1S/C17H25F2NS/c1-2-20-13(12-21-14-7-4-3-5-8-14)11-15-16(18)9-6-10-17(15)19/h6,9-10,13-14,20H,2-5,7-8,11-12H2,1H3 |
| InChIKey | ZZWAGUFUHKSJRB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |