C16H23ClFNS — CID 107884779
1-(4-chloro-3-fluorophenyl)-3-cyclopentylsulfanyl-N-ethylpropan-2-amine (PubChem CID 107884779) has the molecular formula C16H23ClFNS and a molecular weight of 315.88 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-3-cyclopentylsulfanyl-N-ethylpropan-2-amine.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-3-cyclopentylsulfanyl-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 107884779 |
| Molecular Formula | C16H23ClFNS |
| Molecular Weight | 315.88 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-3-cyclopentylsulfanyl-N-ethylpropan-2-amine |
| SMILES | CCNC(CSC1CCCC1)Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C16H23ClFNS/c1-2-19-13(11-20-14-5-3-4-6-14)9-12-7-8-15(17)16(18)10-12/h7-8,10,13-14,19H,2-6,9,11H2,1H3 |
| InChIKey | SASZFBCSKJTWBT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.88 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |