C13H19F2NS — CID 114932102
1-butan-2-ylsulfanyl-3-(2,6-difluorophenyl)propan-2-amine (PubChem CID 114932102) has the molecular formula C13H19F2NS and a molecular weight of 259.37 g/mol. Its IUPAC name is 1-butan-2-ylsulfanyl-3-(2,6-difluorophenyl)propan-2-amine.
| Compound Name | 1-butan-2-ylsulfanyl-3-(2,6-difluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 114932102 |
| Molecular Formula | C13H19F2NS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 1-butan-2-ylsulfanyl-3-(2,6-difluorophenyl)propan-2-amine |
| SMILES | CCC(C)SCC(N)Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H19F2NS/c1-3-9(2)17-8-10(16)7-11-12(14)5-4-6-13(11)15/h4-6,9-10H,3,7-8,16H2,1-2H3 |
| InChIKey | HARHXUMQEYKAKY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |