C13H17F2N — CID 105005725
1-(2,6-difluorophenyl)-4-methylidenehexan-2-amine (PubChem CID 105005725) has the molecular formula C13H17F2N and a molecular weight of 225.28 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-4-methylidenehexan-2-amine.
| Compound Name | 1-(2,6-difluorophenyl)-4-methylidenehexan-2-amine |
|---|---|
| PubChem CID | 105005725 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 1-(2,6-difluorophenyl)-4-methylidenehexan-2-amine |
| SMILES | C=C(CC)CC(N)Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H17F2N/c1-3-9(2)7-10(16)8-11-12(14)5-4-6-13(11)15/h4-6,10H,2-3,7-8,16H2,1H3 |
| InChIKey | YDUJITRIGLRMHL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|