C16H21ClO — CID 115484426
2-bicyclo[2.2.1]heptanyl-(2-chloro-4,5-dimethylphenyl)methanol (PubChem CID 115484426) has the molecular formula C16H21ClO and a molecular weight of 264.80 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl-(2-chloro-4,5-dimethylphenyl)methanol.
| Compound Name | 2-bicyclo[2.2.1]heptanyl-(2-chloro-4,5-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 115484426 |
| Molecular Formula | C16H21ClO |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl-(2-chloro-4,5-dimethylphenyl)methanol |
| SMILES | Cc1cc(Cl)c(C(O)C2CC3CCC2C3)cc1C |
| InChI | InChI=1S/C16H21ClO/c1-9-5-14(15(17)6-10(9)2)16(18)13-8-11-3-4-12(13)7-11/h5-6,11-13,16,18H,3-4,7-8H2,1-2H3 |
| InChIKey | BYQFIXBQOCVWEA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |