C15H19ClO2 — CID 113383462
2-bicyclo[2.2.1]heptanyl-(5-chloro-2-methoxyphenyl)methanol (PubChem CID 113383462) has the molecular formula C15H19ClO2 and a molecular weight of 266.77 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl-(5-chloro-2-methoxyphenyl)methanol.
| Compound Name | 2-bicyclo[2.2.1]heptanyl-(5-chloro-2-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 113383462 |
| Molecular Formula | C15H19ClO2 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl-(5-chloro-2-methoxyphenyl)methanol |
| SMILES | COc1ccc(Cl)cc1C(O)C1CC2CCC1C2 |
| InChI | InChI=1S/C15H19ClO2/c1-18-14-5-4-11(16)8-13(14)15(17)12-7-9-2-3-10(12)6-9/h4-5,8-10,12,15,17H,2-3,6-7H2,1H3 |
| InChIKey | XIOVJDBGYNRTMZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |