C16H23ClO2 — CID 107181861
(5-chloro-2-methoxyphenyl)-(2,2-dimethylcyclohexyl)methanol (PubChem CID 107181861) has the molecular formula C16H23ClO2 and a molecular weight of 282.81 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)-(2,2-dimethylcyclohexyl)methanol.
| Compound Name | (5-chloro-2-methoxyphenyl)-(2,2-dimethylcyclohexyl)methanol |
|---|---|
| PubChem CID | 107181861 |
| Molecular Formula | C16H23ClO2 |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)-(2,2-dimethylcyclohexyl)methanol |
| SMILES | COc1ccc(Cl)cc1C(O)C1CCCCC1(C)C |
| InChI | InChI=1S/C16H23ClO2/c1-16(2)9-5-4-6-13(16)15(18)12-10-11(17)7-8-14(12)19-3/h7-8,10,13,15,18H,4-6,9H2,1-3H3 |
| InChIKey | XSGUROYLZXJIRF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |