C17H25BrO3 — CID 107181873
(3-bromo-2,4-dimethoxyphenyl)-(2,2-dimethylcyclohexyl)methanol (PubChem CID 107181873) has the molecular formula C17H25BrO3 and a molecular weight of 357.29 g/mol. Its IUPAC name is (3-bromo-2,4-dimethoxyphenyl)-(2,2-dimethylcyclohexyl)methanol.
| Compound Name | (3-bromo-2,4-dimethoxyphenyl)-(2,2-dimethylcyclohexyl)methanol |
|---|---|
| PubChem CID | 107181873 |
| Molecular Formula | C17H25BrO3 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (3-bromo-2,4-dimethoxyphenyl)-(2,2-dimethylcyclohexyl)methanol |
| SMILES | COc1ccc(C(O)C2CCCCC2(C)C)c(OC)c1Br |
| InChI | InChI=1S/C17H25BrO3/c1-17(2)10-6-5-7-12(17)15(19)11-8-9-13(20-3)14(18)16(11)21-4/h8-9,12,15,19H,5-7,10H2,1-4H3 |
| InChIKey | CVYOVSKZJNHFSY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |