C18H21FO — CID 107181750
(2,2-dimethylcyclopentyl)-(4-fluoronaphthalen-1-yl)methanol (PubChem CID 107181750) has the molecular formula C18H21FO and a molecular weight of 272.36 g/mol. Its IUPAC name is (2,2-dimethylcyclopentyl)-(4-fluoronaphthalen-1-yl)methanol.
| Compound Name | (2,2-dimethylcyclopentyl)-(4-fluoronaphthalen-1-yl)methanol |
|---|---|
| PubChem CID | 107181750 |
| Molecular Formula | C18H21FO |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (2,2-dimethylcyclopentyl)-(4-fluoronaphthalen-1-yl)methanol |
| SMILES | CC1(C)CCCC1C(O)c1ccc(F)c2ccccc12 |
| InChI | InChI=1S/C18H21FO/c1-18(2)11-5-8-15(18)17(20)14-9-10-16(19)13-7-4-3-6-12(13)14/h3-4,6-7,9-10,15,17,20H,5,8,11H2,1-2H3 |
| InChIKey | HDRIPIYLXRAUSJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |