C14H18F2O — CID 107192212
(3,5-difluorophenyl)-(2,2-dimethylcyclopentyl)methanol (PubChem CID 107192212) has the molecular formula C14H18F2O and a molecular weight of 240.29 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(2,2-dimethylcyclopentyl)methanol.
| Compound Name | (3,5-difluorophenyl)-(2,2-dimethylcyclopentyl)methanol |
|---|---|
| PubChem CID | 107192212 |
| Molecular Formula | C14H18F2O |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (3,5-difluorophenyl)-(2,2-dimethylcyclopentyl)methanol |
| SMILES | CC1(C)CCCC1C(O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H18F2O/c1-14(2)5-3-4-12(14)13(17)9-6-10(15)8-11(16)7-9/h6-8,12-13,17H,3-5H2,1-2H3 |
| InChIKey | MFXXPZVVLRVWKA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |