C14H18Cl2O — CID 107181647
(2,5-dichlorophenyl)-(2,2-dimethylcyclopentyl)methanol (PubChem CID 107181647) has the molecular formula C14H18Cl2O and a molecular weight of 273.20 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(2,2-dimethylcyclopentyl)methanol.
| Compound Name | (2,5-dichlorophenyl)-(2,2-dimethylcyclopentyl)methanol |
|---|---|
| PubChem CID | 107181647 |
| Molecular Formula | C14H18Cl2O |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | (2,5-dichlorophenyl)-(2,2-dimethylcyclopentyl)methanol |
| SMILES | CC1(C)CCCC1C(O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H18Cl2O/c1-14(2)7-3-4-11(14)13(17)10-8-9(15)5-6-12(10)16/h5-6,8,11,13,17H,3-4,7H2,1-2H3 |
| InChIKey | ULHJXMSFCZSYFS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |