C15H19BrClFO — CID 107181881
(4-bromo-5-chloro-2-fluorophenyl)-(2,2-dimethylcyclohexyl)methanol (PubChem CID 107181881) has the molecular formula C15H19BrClFO and a molecular weight of 349.67 g/mol. Its IUPAC name is (4-bromo-5-chloro-2-fluorophenyl)-(2,2-dimethylcyclohexyl)methanol.
| Compound Name | (4-bromo-5-chloro-2-fluorophenyl)-(2,2-dimethylcyclohexyl)methanol |
|---|---|
| PubChem CID | 107181881 |
| Molecular Formula | C15H19BrClFO |
| Molecular Weight | 349.67 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | (4-bromo-5-chloro-2-fluorophenyl)-(2,2-dimethylcyclohexyl)methanol |
| SMILES | CC1(C)CCCCC1C(O)c1cc(Cl)c(Br)cc1F |
| InChI | InChI=1S/C15H19BrClFO/c1-15(2)6-4-3-5-10(15)14(19)9-7-12(17)11(16)8-13(9)18/h7-8,10,14,19H,3-6H2,1-2H3 |
| InChIKey | HQGZRCBDZWFICQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|