C14H18BrClFN — CID 107001432
N-[(4-bromo-5-chloro-2-fluorophenyl)-(2,2-dimethylcyclopropyl)methyl]ethanamine (PubChem CID 107001432) has the molecular formula C14H18BrClFN and a molecular weight of 334.66 g/mol. Its IUPAC name is N-[(4-bromo-5-chloro-2-fluorophenyl)-(2,2-dimethylcyclopropyl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-5-chloro-2-fluorophenyl)-(2,2-dimethylcyclopropyl)methyl]ethanamine |
|---|---|
| PubChem CID | 107001432 |
| Molecular Formula | C14H18BrClFN |
| Molecular Weight | 334.66 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-[(4-bromo-5-chloro-2-fluorophenyl)-(2,2-dimethylcyclopropyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(Cl)c(Br)cc1F)C1CC1(C)C |
| InChI | InChI=1S/C14H18BrClFN/c1-4-18-13(9-7-14(9,2)3)8-5-11(16)10(15)6-12(8)17/h5-6,9,13,18H,4,7H2,1-3H3 |
| InChIKey | UVVVHSBNSUHAPG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.66 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|