C15H12BrClF3N — CID 105399065
N-[(4-bromo-5-chloro-2-fluorophenyl)-(2,6-difluorophenyl)methyl]ethanamine (PubChem CID 105399065) has the molecular formula C15H12BrClF3N and a molecular weight of 378.62 g/mol. Its IUPAC name is N-[(4-bromo-5-chloro-2-fluorophenyl)-(2,6-difluorophenyl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-5-chloro-2-fluorophenyl)-(2,6-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105399065 |
| Molecular Formula | C15H12BrClF3N |
| Molecular Weight | 378.62 g/mol |
| Exact Mass | 376.98 |
| IUPAC Name | N-[(4-bromo-5-chloro-2-fluorophenyl)-(2,6-difluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(Cl)c(Br)cc1F)c1c(F)cccc1F |
| InChI | InChI=1S/C15H12BrClF3N/c1-2-21-15(14-11(18)4-3-5-12(14)19)8-6-10(17)9(16)7-13(8)20/h3-7,15,21H,2H2,1H3 |
| InChIKey | UZJGGBAISYURSP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.62 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|