C16H15BrCl2FN — CID 106861169
N-[(4-bromo-5-chloro-2-fluorophenyl)-(2-chloro-4-methylphenyl)methyl]ethanamine (PubChem CID 106861169) has the molecular formula C16H15BrCl2FN and a molecular weight of 391.11 g/mol. Its IUPAC name is N-[(4-bromo-5-chloro-2-fluorophenyl)-(2-chloro-4-methylphenyl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-5-chloro-2-fluorophenyl)-(2-chloro-4-methylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 106861169 |
| Molecular Formula | C16H15BrCl2FN |
| Molecular Weight | 391.11 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | N-[(4-bromo-5-chloro-2-fluorophenyl)-(2-chloro-4-methylphenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(Cl)c(Br)cc1F)c1ccc(C)cc1Cl |
| InChI | InChI=1S/C16H15BrCl2FN/c1-3-21-16(10-5-4-9(2)6-13(10)18)11-7-14(19)12(17)8-15(11)20/h4-8,16,21H,3H2,1-2H3 |
| InChIKey | QEFKQUGECNNUAC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.11 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|