C16H15BrClF2N — CID 107476402
N-[(2-bromo-4-methylphenyl)-(2-chloro-4,5-difluorophenyl)methyl]ethanamine (PubChem CID 107476402) has the molecular formula C16H15BrClF2N and a molecular weight of 374.66 g/mol. Its IUPAC name is N-[(2-bromo-4-methylphenyl)-(2-chloro-4,5-difluorophenyl)methyl]ethanamine.
| Compound Name | N-[(2-bromo-4-methylphenyl)-(2-chloro-4,5-difluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 107476402 |
| Molecular Formula | C16H15BrClF2N |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | N-[(2-bromo-4-methylphenyl)-(2-chloro-4,5-difluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1cc(F)c(F)cc1Cl)c1ccc(C)cc1Br |
| InChI | InChI=1S/C16H15BrClF2N/c1-3-21-16(10-5-4-9(2)6-12(10)17)11-7-14(19)15(20)8-13(11)18/h4-8,16,21H,3H2,1-2H3 |
| InChIKey | LPOSQLMCDZFJDS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|