C17H22BrClFN — CID 105399168
N-[7-bicyclo[4.1.0]heptanyl-(4-bromo-5-chloro-2-fluorophenyl)methyl]propan-1-amine (PubChem CID 105399168) has the molecular formula C17H22BrClFN and a molecular weight of 374.73 g/mol. Its IUPAC name is N-[7-bicyclo[4.1.0]heptanyl-(4-bromo-5-chloro-2-fluorophenyl)methyl]propan-1-amine.
| Compound Name | N-[7-bicyclo[4.1.0]heptanyl-(4-bromo-5-chloro-2-fluorophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 105399168 |
| Molecular Formula | C17H22BrClFN |
| Molecular Weight | 374.73 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | N-[7-bicyclo[4.1.0]heptanyl-(4-bromo-5-chloro-2-fluorophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cc(Cl)c(Br)cc1F)C1C2CCCCC21 |
| InChI | InChI=1S/C17H22BrClFN/c1-2-7-21-17(16-10-5-3-4-6-11(10)16)12-8-14(19)13(18)9-15(12)20/h8-11,16-17,21H,2-7H2,1H3 |
| InChIKey | YYLLUVOICINZFZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.73 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|