C12H11BrClF6N — CID 105399126
1-(4-bromo-5-chloro-2-fluorophenyl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine (PubChem CID 105399126) has the molecular formula C12H11BrClF6N and a molecular weight of 398.57 g/mol. Its IUPAC name is 1-(4-bromo-5-chloro-2-fluorophenyl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine.
| Compound Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 105399126 |
| Molecular Formula | C12H11BrClF6N |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine |
| SMILES | CCCNC(c1cc(Cl)c(Br)cc1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11BrClF6N/c1-2-3-21-10(11(16,17)12(18,19)20)6-4-8(14)7(13)5-9(6)15/h4-5,10,21H,2-3H2,1H3 |
| InChIKey | WJZJWNWJBDSDPI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|