C12H16F5NS — CID 43496834
1-(2,5-dimethylthiophen-3-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine (PubChem CID 43496834) has the molecular formula C12H16F5NS and a molecular weight of 301.32 g/mol. Its IUPAC name is 1-(2,5-dimethylthiophen-3-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine.
| Compound Name | 1-(2,5-dimethylthiophen-3-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 43496834 |
| Molecular Formula | C12H16F5NS |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 1-(2,5-dimethylthiophen-3-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine |
| SMILES | CCCNC(c1cc(C)sc1C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H16F5NS/c1-4-5-18-10(11(13,14)12(15,16)17)9-6-7(2)19-8(9)3/h6,10,18H,4-5H2,1-3H3 |
| InChIKey | BNXVRSFJKOBWLK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|