C10H11BrF5NS — CID 61103795
1-(5-bromothiophen-2-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine (PubChem CID 61103795) has the molecular formula C10H11BrF5NS and a molecular weight of 352.17 g/mol. Its IUPAC name is 1-(5-bromothiophen-2-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine.
| Compound Name | 1-(5-bromothiophen-2-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 61103795 |
| Molecular Formula | C10H11BrF5NS |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 1-(5-bromothiophen-2-yl)-2,2,3,3,3-pentafluoro-N-propylpropan-1-amine |
| SMILES | CCCNC(c1ccc(Br)s1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11BrF5NS/c1-2-5-17-8(6-3-4-7(11)18-6)9(12,13)10(14,15)16/h3-4,8,17H,2,5H2,1H3 |
| InChIKey | AAZCOZKDRLDULO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|