C12H16BrClFN — CID 105398791
1-(4-bromo-5-chloro-2-fluorophenyl)-N,2,2-trimethylpropan-1-amine (PubChem CID 105398791) has the molecular formula C12H16BrClFN and a molecular weight of 308.62 g/mol. Its IUPAC name is 1-(4-bromo-5-chloro-2-fluorophenyl)-N,2,2-trimethylpropan-1-amine.
| Compound Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-N,2,2-trimethylpropan-1-amine |
|---|---|
| PubChem CID | 105398791 |
| Molecular Formula | C12H16BrClFN |
| Molecular Weight | 308.62 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-N,2,2-trimethylpropan-1-amine |
| SMILES | CNC(c1cc(Cl)c(Br)cc1F)C(C)(C)C |
| InChI | InChI=1S/C12H16BrClFN/c1-12(2,3)11(16-4)7-5-9(14)8(13)6-10(7)15/h5-6,11,16H,1-4H3 |
| InChIKey | XKYNDLMBMCVDKR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|