C11H11BrClF4NO — CID 103207983
1-(4-bromo-5-chloro-2-fluorophenyl)-N-methyl-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 103207983) has the molecular formula C11H11BrClF4NO and a molecular weight of 364.56 g/mol. Its IUPAC name is 1-(4-bromo-5-chloro-2-fluorophenyl)-N-methyl-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-N-methyl-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 103207983 |
| Molecular Formula | C11H11BrClF4NO |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 362.96 |
| IUPAC Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-N-methyl-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | CNC(COCC(F)(F)F)c1cc(Cl)c(Br)cc1F |
| InChI | InChI=1S/C11H11BrClF4NO/c1-18-10(4-19-5-11(15,16)17)6-2-8(13)7(12)3-9(6)14/h2-3,10,18H,4-5H2,1H3 |
| InChIKey | VYOSYMJTWKLLPO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|