C15H20BrCl2F — CID 105399637
1-bromo-2-chloro-4-(1-chloro-3,5,5-trimethylhexyl)-5-fluorobenzene (PubChem CID 105399637) has the molecular formula C15H20BrCl2F and a molecular weight of 370.13 g/mol. Its IUPAC name is 1-bromo-2-chloro-4-(1-chloro-3,5,5-trimethylhexyl)-5-fluorobenzene.
| Compound Name | 1-bromo-2-chloro-4-(1-chloro-3,5,5-trimethylhexyl)-5-fluorobenzene |
|---|---|
| PubChem CID | 105399637 |
| Molecular Formula | C15H20BrCl2F |
| Molecular Weight | 370.13 g/mol |
| Exact Mass | 368.01 |
| IUPAC Name | 1-bromo-2-chloro-4-(1-chloro-3,5,5-trimethylhexyl)-5-fluorobenzene |
| SMILES | CC(CC(Cl)c1cc(Cl)c(Br)cc1F)CC(C)(C)C |
| InChI | InChI=1S/C15H20BrCl2F/c1-9(8-15(2,3)4)5-12(17)10-6-13(18)11(16)7-14(10)19/h6-7,9,12H,5,8H2,1-4H3 |
| InChIKey | KYYNXDVDYRROBR-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.13 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|