C15H23ClFN — CID 105397495
1-(2-chloro-5-fluorophenyl)-3,5,5-trimethylhexan-1-amine (PubChem CID 105397495) has the molecular formula C15H23ClFN and a molecular weight of 271.81 g/mol. Its IUPAC name is 1-(2-chloro-5-fluorophenyl)-3,5,5-trimethylhexan-1-amine.
| Compound Name | 1-(2-chloro-5-fluorophenyl)-3,5,5-trimethylhexan-1-amine |
|---|---|
| PubChem CID | 105397495 |
| Molecular Formula | C15H23ClFN |
| Molecular Weight | 271.81 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1-(2-chloro-5-fluorophenyl)-3,5,5-trimethylhexan-1-amine |
| SMILES | CC(CC(N)c1cc(F)ccc1Cl)CC(C)(C)C |
| InChI | InChI=1S/C15H23ClFN/c1-10(9-15(2,3)4)7-14(18)12-8-11(17)5-6-13(12)16/h5-6,8,10,14H,7,9,18H2,1-4H3 |
| InChIKey | AGUQKGRCQLSBGM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.81 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |