C16H25F2N — CID 107516044
1-(2,3-difluoro-4-methylphenyl)-3,5,5-trimethylhexan-1-amine (PubChem CID 107516044) has the molecular formula C16H25F2N and a molecular weight of 269.38 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-methylphenyl)-3,5,5-trimethylhexan-1-amine.
| Compound Name | 1-(2,3-difluoro-4-methylphenyl)-3,5,5-trimethylhexan-1-amine |
|---|---|
| PubChem CID | 107516044 |
| Molecular Formula | C16H25F2N |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 1-(2,3-difluoro-4-methylphenyl)-3,5,5-trimethylhexan-1-amine |
| SMILES | Cc1ccc(C(N)CC(C)CC(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C16H25F2N/c1-10(9-16(3,4)5)8-13(19)12-7-6-11(2)14(17)15(12)18/h6-7,10,13H,8-9,19H2,1-5H3 |
| InChIKey | AWXPRSTVIKCQRU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |