C18H31N — CID 115816480
1-(3,4-dimethylphenyl)-4,6,6-trimethylheptan-2-amine (PubChem CID 115816480) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-4,6,6-trimethylheptan-2-amine.
| Compound Name | 1-(3,4-dimethylphenyl)-4,6,6-trimethylheptan-2-amine |
|---|---|
| PubChem CID | 115816480 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-4,6,6-trimethylheptan-2-amine |
| SMILES | Cc1ccc(CC(N)CC(C)CC(C)(C)C)cc1C |
| InChI | InChI=1S/C18H31N/c1-13(12-18(4,5)6)9-17(19)11-16-8-7-14(2)15(3)10-16/h7-8,10,13,17H,9,11-12,19H2,1-6H3 |
| InChIKey | SLFATKHTPKXVJY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |