C14H23NO — CID 79198122
1-(3,4-dimethylphenyl)-3-methoxy-3-methylbutan-2-amine (PubChem CID 79198122) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-methoxy-3-methylbutan-2-amine.
| Compound Name | 1-(3,4-dimethylphenyl)-3-methoxy-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 79198122 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-methoxy-3-methylbutan-2-amine |
| SMILES | COC(C)(C)C(N)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H23NO/c1-10-6-7-12(8-11(10)2)9-13(15)14(3,4)16-5/h6-8,13H,9,15H2,1-5H3 |
| InChIKey | JJXJQOFXIBQCLX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |